Difference between revisions of "PWY-6313"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octadec-2-enoyl-ACPs Octadec-2-enoyl-ACPs] == * common name: ** a trans-octadec-2-enoyl-[acp] *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octadec-2-enoyl-ACPs Octadec-2-enoyl-ACPs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a trans-octadec-2-enoyl-[acp] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** trans-2,3-stearoyl-[acp] |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN3O-5293]] | ||
+ | * [[RXN-9635]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-9634]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[R369]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a trans-octadec-2-enoyl-[acp]}} | |
− | + | {{#set: common name=trans-2,3-stearoyl-[acp]}} | |
− | + | {{#set: consumed by=RXN3O-5293|RXN-9635}} | |
− | + | {{#set: produced by=RXN-9634}} | |
− | + | {{#set: consumed or produced by=R369}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: produced by= | + |
Revision as of 15:43, 10 January 2018
Contents
Metabolite Octadec-2-enoyl-ACPs
- common name:
- a trans-octadec-2-enoyl-[acp]
- Synonym(s):
- trans-2,3-stearoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a trans-octadec-2-enoyl-[acp" cannot be used as a page name in this wiki.
"trans-2,3-stearoyl-[acp" cannot be used as a page name in this wiki.