Difference between revisions of "Tiso gene 8673"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.47-RXN 3.2.1.47-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.47-RXN 3.2.1.47-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/3.2.1.47 EC-3.2.1.47] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[D-GALACTOSYL-14-D-GALACTOSYL-14-D-]][c] '''=>''' 1 [[D-galactopyranose]][c] '''+''' 1 [[Lactosyl-Ceramides]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 H2O[c] '''+''' 1 a globotriosylceramide[c] '''=>''' 1 D-galactopyranose[c] '''+''' 1 a lactosylceramide[c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_3392]] | ||
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[athaliana]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21115 21115] |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-3.2.1.47}} | |
| − | + | {{#set: gene associated=Tiso_gene_3392}} | |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | {{#set: reconstruction source=athaliana}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:06, 10 January 2018
Contents
Reaction 3.2.1.47-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 D-GALACTOSYL-14-D-GALACTOSYL-14-D-[c] => 1 D-galactopyranose[c] + 1 Lactosyl-Ceramides[c]
- With common name(s):
- 1 H2O[c] + 1 a globotriosylceramide[c] => 1 D-galactopyranose[c] + 1 a lactosylceramide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
- RHEA:
