Difference between revisions of "Tiso gene 16773"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13092 == * left end position: ** 26 * transcription direction: ** POSITIVE * right end position: ** 2421 * centisome position: ** 0.3977359...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_13092 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] ==
* left end position:
+
* smiles:
** 26
+
** C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
* right end position:
+
* common name:
** 2421
+
** pppGpp
* centisome position:
+
* molecular weight:
** 0.39773598    
+
** 677.095    
 
* Synonym(s):
 
* Synonym(s):
 +
** guanosine pentaphosphate
 +
** guanosine 3'-diphosphate 5'-triphosphate
 +
** guanosine 5'-triphosphate,3'-diphosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GDPMANDEHYDRA-RXN]]
+
* [[RXN0-6427]]
** experimental_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[GTPPYPHOSKIN-RXN]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[GDPRHAMSYN-PWY]]
+
* [[PWY-7573]]
+
* [[PWY-5740]]
+
* [[PWY-66]]
+
* [[PWY-5738]]
+
* [[PWY-5739]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=26}}
+
* LIGAND-CPD:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494]
{{#set: right end position=2421}}
+
* CHEBI:
{{#set: centisome position=0.39773598   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690]
{{#set: reaction associated=GDPMANDEHYDRA-RXN}}
+
* BIGG : gdptp
{{#set: pathway associated=GDPRHAMSYN-PWY|PWY-7573|PWY-5740|PWY-66|PWY-5738|PWY-5739}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549]
 +
* HMDB : HMDB60480
 +
{{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
 +
{{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}}
 +
{{#set: common name=pppGpp}}
 +
{{#set: molecular weight=677.095   }}
 +
{{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}}
 +
{{#set: consumed by=RXN0-6427}}
 +
{{#set: produced by=GTPPYPHOSKIN-RXN}}

Revision as of 17:07, 10 January 2018

Metabolite GDP-TP

  • smiles:
    • C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
  • common name:
    • pppGpp
  • molecular weight:
    • 677.095
  • Synonym(s):
    • guanosine pentaphosphate
    • guanosine 3'-diphosphate 5'-triphosphate
    • guanosine 5'-triphosphate,3'-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP(O)([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.