Difference between revisions of "RXN-18082"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6948 RXN0-6948] == * direction: ** LEFT-TO-RIGHT * common name: ** n-acetylglutamate_synthase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == * smiles: ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** canavaninosuccinate |
− | * | + | * molecular weight: |
− | ** | + | ** 291.24 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-22]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820246 91820246] | |
− | {{#set: | + | * HMDB : HMDB12197 |
− | {{#set: | + | {{#set: smiles=C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M}} |
− | {{#set: | + | {{#set: common name=canavaninosuccinate}} |
− | {{#set: | + | {{#set: molecular weight=291.24 }} |
− | {{#set: | + | {{#set: consumed by=RXN-22}} |
+ | {{#set: produced by=RXN-10}} |
Revision as of 17:07, 10 January 2018
Contents
Metabolite CANAVANINOSUCCINATE
- smiles:
- C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O
- inchi key:
- InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M
- common name:
- canavaninosuccinate
- molecular weight:
- 291.24
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12197
"C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O" cannot be used as a page name in this wiki.