Difference between revisions of "RXN-11521"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10984 == * left end position: ** 6772 * transcription direction: ** POSITIVE * right end position: ** 8075 * centisome position: ** 83.1226...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * smiles: ** CC(O)(C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=XFTRTWQBIOMV...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10984 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] ==
−
* left end position:
+
* smiles:
−
** 6772
+
** CC(O)(C(=O)[O-])CC(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L
−
* right end position:
+
* common name:
−
** 8075
+
** (R)-citramalate
−
* centisome position:
+
* molecular weight:
−
** 83.12262    
+
** 146.099    
 
* Synonym(s):
 
* Synonym(s):
 +
** (R)-2-methylmalic acid
 +
** (3R)-citramalate
 +
** (3R)-citramalic acid
 +
** (3R)-α-hydroxypyrotartaric acid
 +
** D-citramalate
 +
** D-citramalic acid
 +
** D-α-hydroxypyrotartaric acid
 +
** (R)-2-methylmalate
 +
** (R)-(-)-citramalic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ACYL-COA-HYDROLASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-7743]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-10708]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-735]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6772}}
+
* CAS : 6236-10-8
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=8075}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460281 5460281]
−
{{#set: centisome position=83.12262   }}
+
* CHEMSPIDER:
−
{{#set: reaction associated=ACYL-COA-HYDROLASE-RXN|RXN-10708}}
+
** [http://www.chemspider.com/Chemical-Structure.4573870.html 4573870]
−
{{#set: pathway associated=PWY-735}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30934 30934]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02612 C02612]
 +
{{#set: smiles=CC(O)(C(=O)[O-])CC(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L}}
 +
{{#set: common name=(R)-citramalate}}
 +
{{#set: molecular weight=146.099   }}
 +
{{#set: common name=(R)-2-methylmalic acid|(3R)-citramalate|(3R)-citramalic acid|(3R)-α-hydroxypyrotartaric acid|D-citramalate|D-citramalic acid|D-α-hydroxypyrotartaric acid|(R)-2-methylmalate|(R)-(-)-citramalic acid}}
 +
{{#set: produced by=RXN-7743}}

Revision as of 17:07, 10 January 2018

Metabolite CPD-31

  • smiles:
    • CC(O)(C(=O)[O-])CC(=O)[O-]
  • inchi key:
    • InChIKey=XFTRTWQBIOMVPK-RXMQYKEDSA-L
  • common name:
    • (R)-citramalate
  • molecular weight:
    • 146.099
  • Synonym(s):
    • (R)-2-methylmalic acid
    • (3R)-citramalate
    • (3R)-citramalic acid
    • (3R)-α-hydroxypyrotartaric acid
    • D-citramalate
    • D-citramalic acid
    • D-α-hydroxypyrotartaric acid
    • (R)-2-methylmalate
    • (R)-(-)-citramalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)(C(=O)[O-])CC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-11521&oldid=16253"