Difference between revisions of "CPD-19179"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] == * smiles: ** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15745 RXN-15745] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15745 RXN-15745] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[ETR-Quinones]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an electron-transfer quinone[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 glycerone phosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_15777]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-4261]], glycerol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4261 PWY-4261] | ||
| + | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
| + | * [[PWY-6118]], glycerol-3-phosphate shuttle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6118 PWY-6118] | ||
| + | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
| + | * [[PWY-6952]], glycerophosphodiester degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6952 PWY-6952] | ||
| + | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[esiliculosus]] | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[experimental_annotation]] | ||
| + | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.1.5.3}} | |
| − | + | {{#set: gene associated=Tiso_gene_15777}} | |
| − | + | {{#set: in pathway=PWY-4261|PWY-6118|PWY-6952}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=esiliculosus}} | |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:08, 10 January 2018
Contents
Reaction RXN-15745
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ETR-Quinones[c] + 1 GLYCEROL-3P[c] => 1 ETR-Quinols[c] + 1 DIHYDROXY-ACETONE-PHOSPHATE[c]
- With common name(s):
- 1 an electron-transfer quinone[c] + 1 sn-glycerol 3-phosphate[c] => 1 an electron-transfer quinol[c] + 1 glycerone phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-4261, glycerol degradation I: PWY-4261
- 2 reactions found over 2 reactions in the full pathway
- PWY-6118, glycerol-3-phosphate shuttle: PWY-6118
- 2 reactions found over 2 reactions in the full pathway
- PWY-6952, glycerophosphodiester degradation: PWY-6952
- 2 reactions found over 2 reactions in the full pathway
