Difference between revisions of "CPD-13695"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEME_C HEME_C] == * common name: ** heme c * Synonym(s): == Reaction(s) known to consume the c...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEME_C HEME_C] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] ==
 +
* smiles:
 +
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
 
* common name:
 
* common name:
** heme c
+
** 6-oxocampestanol
 +
* molecular weight:
 +
** 416.686   
 
* Synonym(s):
 
* Synonym(s):
 +
** oxocampestanol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-715]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=heme c}}
+
* PUBCHEM:
{{#set: consumed or produced by=HOLOCYTOCHROME-C-SYNTHASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061347 16061347]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20747 20747]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789]
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}}
 +
{{#set: common name=6-oxocampestanol}}
 +
{{#set: molecular weight=416.686    }}
 +
{{#set: common name=oxocampestanol}}
 +
{{#set: consumed by=RXN-715}}

Revision as of 17:09, 10 January 2018

Metabolite CPD-713

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
  • common name:
    • 6-oxocampestanol
  • molecular weight:
    • 416.686
  • Synonym(s):
    • oxocampestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.