Difference between revisions of "Cis-vaccen-2-enoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYTIKIN-RXN CYTIKIN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYTIKIN-RXN CYTIKIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** COC1(=CC(=CCCO)C=CC(=O)1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.1.213 EC-2.7.1.213]
+
** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
 +
* common name:
 +
** coniferyl alcohol radical
 +
* molecular weight:
 +
** 179.195   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CYTIDINE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[CMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
+
* [[RXN-17352]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 cytidine[c] '''+''' 1 ATP[c] '''=>''' 1 CMP[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5532]], nucleoside and nucleotide degradation (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532]
+
−
** '''3''' reactions found over '''10''' reactions in the full pathway
+
−
* [[PWY-7193]], pyrimidine ribonucleosides salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7193 PWY-7193]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
{{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24674 24674]
+
{{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}}
−
* LIGAND-RXN:
+
{{#set: common name=coniferyl alcohol radical}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00513 R00513]
+
{{#set: molecular weight=179.195    }}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: produced by=RXN-17352}}
−
{{#set: ec number=EC-2.7.1.213}}
+
−
{{#set: in pathway=PWY-5532|PWY-7193}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 18:10, 10 January 2018

Metabolite CPD-18761

  • smiles:
    • COC1(=CC(=CCCO)C=CC(=O)1)
  • inchi key:
    • InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
  • common name:
    • coniferyl alcohol radical
  • molecular weight:
    • 179.195
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-vaccen-2-enoyl-ACPs&oldid=16488"