Difference between revisions of "BCCP-dimers"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * inchi key: ** InChIKey=OUGL...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-URACIL-5--METHYLTRANSFERASE-RXN TRNA-URACIL-5--METHYLTRANSFERASE-RXN] == * direction: ** LEFT-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-URACIL-5--METHYLTRANSFERASE-RXN TRNA-URACIL-5--METHYLTRANSFERASE-RXN] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.1.1.35 EC-2.1.1.35] |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[Uracil-54-in-tRNA]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[tRNA-containing-5Me-uridine54]][c] '''+''' 1 [[PROTON]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 S-adenosyl-L-methionine[c] '''+''' 1 a uracil54 in tRNA[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 a 5-methyluracil54 in tRNA[c] '''+''' 1 H+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_4332]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-RXN: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00594 R00594] |
| − | {{#set: | + | * UNIPROT: |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/P23003 P23003] |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/P31812 P31812] |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PP92 Q9PP92] |
| + | ** [http://www.uniprot.org/uniprot/Q9JT82 Q9JT82] | ||
| + | {{#set: direction=LEFT-TO-RIGHT}} | ||
| + | {{#set: ec number=EC-2.1.1.35}} | ||
| + | {{#set: gene associated=Tiso_gene_4332}} | ||
| + | {{#set: in pathway=}} | ||
| + | {{#set: reconstruction category=orthology}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
| + | {{#set: reconstruction source=esiliculosus}} | ||
Revision as of 17:10, 10 January 2018
Contents
Reaction TRNA-URACIL-5--METHYLTRANSFERASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ADENOSYLMETHIONINE[c] + 1 Uracil-54-in-tRNA[c] => 1 ADENOSYL-HOMO-CYS[c] + 1 tRNA-containing-5Me-uridine54[c] + 1 PROTON[c]
- With common name(s):
- 1 S-adenosyl-L-methionine[c] + 1 a uracil54 in tRNA[c] => 1 S-adenosyl-L-homocysteine[c] + 1 a 5-methyluracil54 in tRNA[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
