Difference between revisions of "COUMARYL-ALCOHOL"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATE-RACEMASE-RXN ASPARTATE-RACEMASE-RXN] == * direction: ** REVERSIBLE * common name: ** ORF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] == * smiles: ** C([O-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+] |
| + | * inchi key: | ||
| + | ** InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** L-α-amino-ε-keto-pimelate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 188.16 |
* Synonym(s): | * Synonym(s): | ||
| + | ** L-2-Amino-6-oxopimelate | ||
| + | ** L-2-Amino-6-oxoheptanedioate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-4821]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202391 25202391] |
| − | * | + | * CHEBI: |
| − | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58556 58556] |
| − | * | + | * LIGAND-CPD: |
| − | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03871 C03871] |
| − | + | {{#set: smiles=C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+]}} | |
| − | + | {{#set: inchi key=InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M}} | |
| − | {{#set: | + | {{#set: common name=L-α-amino-ε-keto-pimelate}} |
| − | + | {{#set: molecular weight=188.16 }} | |
| − | {{#set: | + | {{#set: common name=L-2-Amino-6-oxopimelate|L-2-Amino-6-oxoheptanedioate}} |
| − | {{#set: | + | {{#set: consumed or produced by=RXN-4821}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 16:44, 10 January 2018
Contents
Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE
- smiles:
- C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+]
- inchi key:
- InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M
- common name:
- L-α-amino-ε-keto-pimelate
- molecular weight:
- 188.16
- Synonym(s):
- L-2-Amino-6-oxopimelate
- L-2-Amino-6-oxoheptanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+" cannot be used as a page name in this wiki.
