Difference between revisions of "CPD-14280"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == * smiles: ** C([O-])(=O)C([N+])CC1(C=CC=CC=1) * inchi key: ** InChIKey=COLNVLDHVKWL...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-1-SEMIALDEHYDE GLUTAMATE-1-SEMIALDEHYDE] == * smiles: ** [CH](C(CCC([O-])=O)[N+])=O *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-1-SEMIALDEHYDE GLUTAMATE-1-SEMIALDEHYDE] == |
* smiles: | * smiles: | ||
| − | ** C([O-]) | + | ** [CH](C(CCC([O-])=O)[N+])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MPUUQNGXJSEWTF-BYPYZUCNSA-N |
* common name: | * common name: | ||
| − | ** | + | ** (S)-4-amino-5-oxopentanoate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 131.131 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-glutamate 1-semialdehyde |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GSAAMINOTRANS-RXN]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GLUTRNAREDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244684 25244684] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57501 57501] |
| − | * BIGG : | + | * BIGG : glu1sa |
| − | {{#set: smiles=C([O-]) | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03741 C03741] |
| − | {{#set: common name= | + | {{#set: smiles=[CH](C(CCC([O-])=O)[N+])=O}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=MPUUQNGXJSEWTF-BYPYZUCNSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=(S)-4-amino-5-oxopentanoate}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=131.131 }} |
| − | {{#set: | + | {{#set: common name=L-glutamate 1-semialdehyde}} |
| + | {{#set: consumed by=GSAAMINOTRANS-RXN}} | ||
| + | {{#set: produced by=GLUTRNAREDUCT-RXN}} | ||
Revision as of 17:11, 10 January 2018
Contents
Metabolite GLUTAMATE-1-SEMIALDEHYDE
- smiles:
- [CH](C(CCC([O-])=O)[N+])=O
- inchi key:
- InChIKey=MPUUQNGXJSEWTF-BYPYZUCNSA-N
- common name:
- (S)-4-amino-5-oxopentanoate
- molecular weight:
- 131.131
- Synonym(s):
- L-glutamate 1-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](C(CCC([O-])=O)[N+])=O" cannot be used as a page name in this wiki.
