Difference between revisions of "RXN66-482"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] == * smiles: ** C1(=O)(C(O)C(O)[CH](C(O)C=O)O1) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6313 PWY-6313] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6313 PWY-6313] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** serotonin degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''6''' reaction(s) found | |
− | == Reaction(s) | + | ** [[RXN-10784]] |
− | * [ | + | ** [[RXN-10777]] |
+ | ** [[RXN-10779]] | ||
+ | ** [[RXN-10780]] | ||
+ | ** [[RXN-10781]] | ||
+ | ** [[RXN-10782]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10778 RXN-10778] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: common name=serotonin degradation}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 15:44, 10 January 2018
Pathway PWY-6313
- taxonomic range:
- common name:
- serotonin degradation
- Synonym(s):
Reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found