Difference between revisions of "Tiso gene 10459"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] == * smiles: ** CC(=O)NCCC2(=CNC1(=C(C=C(O)C=C1)2)) * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRADP PRADP] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphoribosyl-ATP diphosphatase, c...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRADP PRADP] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phosphoribosyl-ATP diphosphatase, cytosol |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[PHOSPHORIBOSYL-ATP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[PHOSPHORIBOSYL-AMP]][c] '''+''' 1.0 [[PPI]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1.0 1-(5-phospho-β-D-ribosyl)-ATP[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 H+[c] '''+''' 1.0 1-(5-phospho-β-D-ribosyl)-AMP[c] '''+''' 1.0 diphosphate[c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_11297]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[creinhardtii]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=phosphoribosyl-ATP diphosphatase, cytosol}} | |
| − | + | {{#set: gene associated=Tiso_gene_11297}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=creinhardtii}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:12, 10 January 2018
Contents
Reaction PRADP
- direction:
- LEFT-TO-RIGHT
- common name:
- phosphoribosyl-ATP diphosphatase, cytosol
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 PHOSPHORIBOSYL-ATP[c] + 1.0 WATER[c] => 1.0 PROTON[c] + 1.0 PHOSPHORIBOSYL-AMP[c] + 1.0 PPI[c]
- With common name(s):
- 1.0 1-(5-phospho-β-D-ribosyl)-ATP[c] + 1.0 H2O[c] => 1.0 H+[c] + 1.0 1-(5-phospho-β-D-ribosyl)-AMP[c] + 1.0 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
