Difference between revisions of "ALPHA-GLC-6-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * inchi...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-409 CPD-409] == * common name: ** a 2-acylglycerol * Synonym(s): ** a 2-monoglyceride ** a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-409 CPD-409] ==
−
* smiles:
+
−
** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
+
−
* inchi key:
+
−
** InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L
+
 
* common name:
 
* common name:
−
** α-D-glucose 6-phosphate
+
** a 2-acylglycerol
−
* molecular weight:
+
−
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** α-glucose 6-phosphate
+
** a 2-monoglyceride
−
** α-D-glucose-6-P
+
** a 2-glyceride
 +
** a 2-MAG
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[UG6PGT]]
+
* [[RXN-1603]]
−
* [[UG6PGTn]]
+
−
* [[G6PADHh]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[BFFS]]
+
* [[RXN-1602]]
−
* [[RXN-1685]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[PGIA]]
+
* [[RXN-12383]]
−
* [[PGIAh]]
+
−
* [[G6PI]]
+
−
* [[G6PA_pi_th]]
+
−
* [[RXN-6182]]
+
−
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
+
−
* [[PGMTh]]
+
−
* [[PGCM]]
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 2-acylglycerol}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604864 21604864]
+
{{#set: common name=a 2-monoglyceride|a 2-glyceride|a 2-MAG}}
−
* CHEMSPIDER:
+
{{#set: consumed by=RXN-1603}}
−
** [http://www.chemspider.com/Chemical-Structure.10239175.html 10239175]
+
{{#set: produced by=RXN-1602}}
−
* CHEBI:
+
{{#set: consumed or produced by=RXN-12383}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58225 58225]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00668 C00668]
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L}}
+
−
{{#set: common name=α-D-glucose 6-phosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=α-glucose 6-phosphate|α-D-glucose-6-P}}
+
−
{{#set: consumed by=UG6PGT|UG6PGTn|G6PADHh}}
+
−
{{#set: produced by=BFFS|RXN-1685}}
+
−
{{#set: consumed or produced by=PGIA|PGIAh|G6PI|G6PA_pi_th|RXN-6182|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|PGMTh|PGCM}}
+

Revision as of 17:13, 10 January 2018

Metabolite CPD-409

  • common name:
    • a 2-acylglycerol
  • Synonym(s):
    • a 2-monoglyceride
    • a 2-glyceride
    • a 2-MAG

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ALPHA-GLC-6-P&oldid=16745"