Difference between revisions of "MANNOSE-1P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACCOAtx ACCOAtx] == * direction: ** REVERSIBLE * common name: ** Acetyl-CoA:CoA antiporter, glyoxys...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACCOAtx ACCOAtx] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Acetyl-CoA:CoA antiporter, glyoxysomal |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[ACETYL-COA]][c] '''+''' 1.0 [[CO-A]][x] '''<=>''' 1.0 [[CO-A]][c] '''+''' 1.0 [[ACETYL-COA]][x] |
| − | == | + | * With common name(s): |
| − | == | + | ** 1.0 acetyl-CoA[c] '''+''' 1.0 coenzyme A[x] '''<=>''' 1.0 coenzyme A[c] '''+''' 1.0 acetyl-CoA[x] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_9173]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[creinhardtii]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=Acetyl-CoA:CoA antiporter, glyoxysomal}} | |
| − | + | {{#set: gene associated=Tiso_gene_9173}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=creinhardtii}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:13, 10 January 2018
Contents
Reaction ACCOAtx
- direction:
- REVERSIBLE
- common name:
- Acetyl-CoA:CoA antiporter, glyoxysomal
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 ACETYL-COA[c] + 1.0 CO-A[x] <=> 1.0 CO-A[c] + 1.0 ACETYL-COA[x]
- With common name(s):
- 1.0 acetyl-CoA[c] + 1.0 coenzyme A[x] <=> 1.0 coenzyme A[c] + 1.0 acetyl-CoA[x]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
