Difference between revisions of "Tiso gene 14327"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-527 RXN-527] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * inchi key: ** InChIKey=YJVOWRAWF...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == |
− | * | + | * smiles: |
− | ** | + | ** CCC(O)(C)C(=O)C(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M |
+ | * common name: | ||
+ | ** (R)-3-hydroxy-3-methyl-2-oxopentanoate | ||
+ | * molecular weight: | ||
+ | ** 145.135 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[R05068]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14106]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20846131 20846131] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49257 49257] |
− | {{#set: | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463] | |
− | {{#set: | + | {{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M}} |
− | {{#set: | + | {{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}} |
+ | {{#set: molecular weight=145.135 }} | ||
+ | {{#set: consumed by=R05068}} | ||
+ | {{#set: consumed or produced by=RXN-14106}} |
Revision as of 18:14, 10 January 2018
Contents
Metabolite CPD-15104
- smiles:
- CCC(O)(C)C(=O)C(=O)[O-]
- inchi key:
- InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
- common name:
- (R)-3-hydroxy-3-methyl-2-oxopentanoate
- molecular weight:
- 145.135
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(O)(C)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.