Difference between revisions of "Tiso gene 17314"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_7014 == * left end position: ** 7128 * transcription direction: ** NEGATIVE * right end position: ** 11588 * centisome position: ** 61.3425...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * inchi...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_7014 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] ==
−
* left end position:
+
* smiles:
−
** 7128
+
** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L
−
* right end position:
+
* common name:
−
** 11588
+
** α-D-glucose 6-phosphate
−
* centisome position:
+
* molecular weight:
−
** 61.342514    
+
** 258.121    
 
* Synonym(s):
 
* Synonym(s):
 +
** α-glucose 6-phosphate
 +
** α-D-glucose-6-P
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[IDP]]
+
* [[UG6PGT]]
−
** [[pantograph]]-[[creinhardtii]]
+
* [[UG6PGTn]]
−
* [[INORGPYROPHOSPHAT-RXN]]
+
* [[G6PADHh]]
−
** experimental_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[BFFS]]
−
** [[pantograph]]-[[athaliana]]
+
* [[RXN-1685]]
−
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[creinhardtii]]
+
* [[PGIA]]
−
** [[pantograph]]-[[creinhardtii]]
+
* [[PGIAh]]
−
== Pathways associated ==
+
* [[G6PI]]
−
* [[PWY-7805]]
+
* [[G6PA_pi_th]]
−
* [[PWY-7807]]
+
* [[RXN-6182]]
 +
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 +
* [[PGMTh]]
 +
* [[PGCM]]
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=7128}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604864 21604864]
−
{{#set: right end position=11588}}
+
* CHEMSPIDER:
−
{{#set: centisome position=61.342514   }}
+
** [http://www.chemspider.com/Chemical-Structure.10239175.html 10239175]
−
{{#set: reaction associated=IDP|INORGPYROPHOSPHAT-RXN}}
+
* CHEBI:
−
{{#set: pathway associated=PWY-7805|PWY-7807}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58225 58225]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00668 C00668]
 +
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}}
 +
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L}}
 +
{{#set: common name=α-D-glucose 6-phosphate}}
 +
{{#set: molecular weight=258.121   }}
 +
{{#set: common name=α-glucose 6-phosphate|α-D-glucose-6-P}}
 +
{{#set: consumed by=UG6PGT|UG6PGTn|G6PADHh}}
 +
{{#set: produced by=BFFS|RXN-1685}}
 +
{{#set: consumed or produced by=PGIA|PGIAh|G6PI|G6PA_pi_th|RXN-6182|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|PGMTh|PGCM}}

Revision as of 17:14, 10 January 2018

Metabolite ALPHA-GLC-6-P

  • smiles:
    • C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
  • inchi key:
    • InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L
  • common name:
    • α-D-glucose 6-phosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • α-glucose 6-phosphate
    • α-D-glucose-6-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17314&oldid=16794"