Difference between revisions of "3-DEHYDROQUINATE-DEHYDRATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AIRS-RXN AIRS-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/6....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AIRS-RXN AIRS-RXN] ==
−
* smiles:
+
* direction:
−
** CC1(NC(=O)NC1CCCCCC(=O)[O-])
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/6.3.3.1 EC-6.3.3.1]
−
* common name:
+
−
** dethiobiotin
+
−
* molecular weight:
+
−
** 213.256   
+
 
* Synonym(s):
 
* Synonym(s):
−
** desthiobiotin
 
−
** DTB
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.8.1.6-RXN]]
+
* With identifiers:
−
* [[RXN-17472]]
+
** 1 [[5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[DETHIOBIOTIN-SYN-RXN]]
+
** 1 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 5-amino-1-(5-phospho-β-D-ribosyl)imidazole[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_1369]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
** [[pantograph]]-[[synechocystis]]
 +
== Pathways  ==
 +
* [[PWY-6121]], 5-aminoimidazole ribonucleotide biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6121 PWY-6121]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-6122]], 5-aminoimidazole ribonucleotide biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6122 PWY-6122]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-6277]], superpathway of 5-aminoimidazole ribonucleotide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6277 PWY-6277]
 +
** '''6''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[synechocystis]]
 +
* [[manual]]:
 +
** [[primary_network]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* CAS : 533-48-2
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23032 23032]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244917 25244917]
+
* LIGAND-RXN:
−
* HMDB : HMDB03581
+
** [http://www.genome.jp/dbget-bin/www_bget?R04208 R04208]
−
* LIGAND-CPD:
+
* UNIPROT:
−
** [http://www.genome.jp/dbget-bin/www_bget?C01909 C01909]
+
** [http://www.uniprot.org/uniprot/P07244 P07244]
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/P12043 P12043]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57861 57861]
+
** [http://www.uniprot.org/uniprot/P21872 P21872]
−
* BIGG : dtbt
+
** [http://www.uniprot.org/uniprot/P08178 P08178]
−
{{#set: smiles=CC1(NC(=O)NC1CCCCCC(=O)[O-])}}
+
** [http://www.uniprot.org/uniprot/P00967 P00967]
−
{{#set: inchi key=InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M}}
+
** [http://www.uniprot.org/uniprot/P16340 P16340]
−
{{#set: common name=dethiobiotin}}
+
** [http://www.uniprot.org/uniprot/P22102 P22102]
−
{{#set: molecular weight=213.256    }}
+
** [http://www.uniprot.org/uniprot/Q57656 Q57656]
−
{{#set: common name=desthiobiotin|DTB}}
+
** [http://www.uniprot.org/uniprot/O66968 O66968]
−
{{#set: consumed by=2.8.1.6-RXN|RXN-17472}}
+
** [http://www.uniprot.org/uniprot/Q9JUA2 Q9JUA2]
−
{{#set: produced by=DETHIOBIOTIN-SYN-RXN}}
+
** [http://www.uniprot.org/uniprot/P43848 P43848]
 +
** [http://www.uniprot.org/uniprot/Q9PME0 Q9PME0]
 +
** [http://www.uniprot.org/uniprot/Q64737 Q64737]
 +
** [http://www.uniprot.org/uniprot/P20772 P20772]
 +
** [http://www.uniprot.org/uniprot/Q55422 Q55422]
 +
** [http://www.uniprot.org/uniprot/P52424 P52424]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: ec number=EC-6.3.3.1}}
 +
{{#set: gene associated=Tiso_gene_1369}}
 +
{{#set: in pathway=PWY-6121|PWY-6122|PWY-6277}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=synechocystis}}
 +
{{#set: reconstruction category=manual}}
 +
{{#set: reconstruction source=primary_network}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}

Revision as of 17:14, 10 January 2018

Reaction AIRS-RXN

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6121, 5-aminoimidazole ribonucleotide biosynthesis I: PWY-6121
    • 5 reactions found over 5 reactions in the full pathway
  • PWY-6122, 5-aminoimidazole ribonucleotide biosynthesis II: PWY-6122
    • 4 reactions found over 5 reactions in the full pathway
  • PWY-6277, superpathway of 5-aminoimidazole ribonucleotide biosynthesis: PWY-6277
    • 6 reactions found over 9 reactions in the full pathway

Reconstruction information

External links







Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-DEHYDROQUINATE-DEHYDRATASE-RXN&oldid=16800"