Difference between revisions of "Tiso gene 17377"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17113 RXN-17113] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17113 RXN-17113] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** acyl-coenzyme_a_oxidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[CPD-18491]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-18492]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] '''+''' 1 oxygen[c] '''=>''' 1 (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA[c] '''+''' 1 hydrogen peroxide[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_18566]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7726]], (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726] | ||
+ | ** '''5''' reactions found over '''13''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=acyl-coenzyme_a_oxidase}} | |
− | + | {{#set: ec number=EC-1.3.3.6}} | |
− | + | {{#set: gene associated=Tiso_gene_18566}} | |
− | + | {{#set: in pathway=PWY-7726}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | {{#set: reconstruction source=in-silico_annotation}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:14, 10 January 2018
Contents
Reaction RXN-17113
- direction:
- LEFT-TO-RIGHT
- common name:
- acyl-coenzyme_a_oxidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-18491[c] + 1 OXYGEN-MOLECULE[c] => 1 CPD-18492[c] + 1 HYDROGEN-PEROXIDE[c]
- With common name(s):
- 1 (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] + 1 oxygen[c] => 1 (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA[c] + 1 hydrogen peroxide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_18566
- IN-SILICO_ANNOTATION
- EC-NUMBER
- IN-SILICO_ANNOTATION
Pathways
- PWY-7726, (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): PWY-7726
- 5 reactions found over 13 reactions in the full pathway