Difference between revisions of "Tiso gene 15398"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOP-2229-ENE HOP-2229-ENE] == * smiles: ** C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BNor BNor] == * direction: ** LEFT-TO-RIGHT * common name: ** butanal:NAD+ oxidoreductase (CoA-acyl...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOP-2229-ENE HOP-2229-ENE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BNor BNor] ==
−
* smiles:
+
* direction:
−
** C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N
+
 
* common name:
 
* common name:
−
** hop-22(29)-ene
+
** butanal:NAD+ oxidoreductase (CoA-acylating)
−
* molecular weight:
+
−
** 410.725   
+
 
* Synonym(s):
 
* Synonym(s):
−
** diploptene
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[5.4.99.17-RXN]]
+
** 1.0 [[CO-A]][c] '''+''' 1.0 [[BUTANAL]][c] '''+''' 1.0 [[NAD]][c] '''=>''' 1.0 [[NADH]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[BUTYRYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 coenzyme A[c] '''+''' 1.0 butan-1-al[c] '''+''' 1.0 NAD+[c] '''=>''' 1.0 NADH[c] '''+''' 1.0 H+[c] '''+''' 1.0 butanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2052]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92155 92155]
+
{{#set: common name=butanal:NAD+ oxidoreductase (CoA-acylating)}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_2052}}
−
** [http://www.chemspider.com/Chemical-Structure.83200.html 83200]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4648 4648]
+
{{#set: reconstruction tool=pantograph}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06310 C06310]
+
−
{{#set: smiles=C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))}}
+
−
{{#set: inchi key=InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N}}
+
−
{{#set: common name=hop-22(29)-ene}}
+
−
{{#set: molecular weight=410.725    }}
+
−
{{#set: common name=diploptene}}
+
−
{{#set: produced by=5.4.99.17-RXN}}
+

Revision as of 17:14, 10 January 2018

Reaction BNor

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • butanal:NAD+ oxidoreductase (CoA-acylating)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 coenzyme A[c] + 1.0 butan-1-al[c] + 1.0 NAD+[c] => 1.0 NADH[c] + 1.0 H+[c] + 1.0 butanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15398&oldid=16827"