Difference between revisions of "Tiso gene 3166"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-tRNAs ALA-tRNAs] == * common name: ** a tRNAala * Synonym(s): ** TRNA(ALA) == Reaction(s)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-tRNAs ALA-tRNAs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a tRNAala |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** TRNA(ALA) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ALANINE--TRNA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a tRNAala}} | |
− | + | {{#set: common name=TRNA(ALA)}} | |
− | + | {{#set: consumed by=ALANINE--TRNA-LIGASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + |
Revision as of 17:15, 10 January 2018
Contents
Metabolite ALA-tRNAs
- common name:
- a tRNAala
- Synonym(s):
- TRNA(ALA)