Difference between revisions of "CPD-725"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALTODEXGLUCOSID-RXN MALTODEXGLUCOSID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-715 CPD-715] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-715 CPD-715] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
+ | * inchi key: | ||
+ | ** InChIKey=WPHVOXMMNSLJSF-GUOPQYDVSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 6-deoxoteasterone |
− | * | + | * molecular weight: |
− | ** | + | ** 434.701 |
* Synonym(s): | * Synonym(s): | ||
+ | ** deoxoteasterone | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-775]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-774]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIPID_MAPS : LMST01030120 | |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11144580 11144580] | |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20716 20716] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15799 C15799] |
− | {{#set: | + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-GUOPQYDVSA-N}} |
− | {{#set: | + | {{#set: common name=6-deoxoteasterone}} |
− | {{#set: | + | {{#set: molecular weight=434.701 }} |
+ | {{#set: common name=deoxoteasterone}} | ||
+ | {{#set: consumed by=RXN-775}} | ||
+ | {{#set: produced by=RXN-774}} |
Revision as of 18:15, 10 January 2018
Contents
Metabolite CPD-715
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=WPHVOXMMNSLJSF-GUOPQYDVSA-N
- common name:
- 6-deoxoteasterone
- molecular weight:
- 434.701
- Synonym(s):
- deoxoteasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.