Difference between revisions of "FUMARATE-REDUCTASE-NADH-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.139-RXN 2.7.1.139-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ras-related_gtp-bin...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == |
− | * | + | * smiles: |
− | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45)) |
+ | * inchi key: | ||
+ | ** InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** biotinyl-5'-adenylate |
− | * | + | * molecular weight: |
− | ** | + | ** 572.509 |
* Synonym(s): | * Synonym(s): | ||
+ | ** biotinyl-5'-AMP | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-7192]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239798 53239798] |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62414 62414] |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05921 C05921] |
− | + | * HMDB : HMDB04220 | |
− | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))}} | |
− | + | {{#set: inchi key=InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M}} | |
− | + | {{#set: common name=biotinyl-5'-adenylate}} | |
− | {{#set: | + | {{#set: molecular weight=572.509 }} |
− | {{#set: | + | {{#set: common name=biotinyl-5'-AMP}} |
− | {{#set: | + | {{#set: produced by=RXN0-7192}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:16, 10 January 2018
Contents
Metabolite BIO-5-AMP
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
- inchi key:
- InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
- common name:
- biotinyl-5'-adenylate
- molecular weight:
- 572.509
- Synonym(s):
- biotinyl-5'-AMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))" cannot be used as a page name in this wiki.