Difference between revisions of "Tiso gene 11850"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == * smiles: ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] * inchi key: *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J |
* common name: | * common name: | ||
− | ** | + | ** (R)-mevalonate diphosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 304.087 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** mevalonate-5-PP |
− | ** | + | ** (R)-5-diphosphomevalonate |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 4872-34-8 |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916915 24916915] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57557 57557] |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01143 C01143] |
− | {{#set: common name= | + | * HMDB : HMDB01090 |
− | {{#set: molecular weight= | + | {{#set: smiles=CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J}} |
− | {{#set: consumed by= | + | {{#set: common name=(R)-mevalonate diphosphate}} |
− | + | {{#set: molecular weight=304.087 }} | |
+ | {{#set: common name=mevalonate-5-PP|(R)-5-diphosphomevalonate}} | ||
+ | {{#set: consumed by=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN}} |
Revision as of 18:17, 10 January 2018
Contents
Metabolite CPD-641
- smiles:
- CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]
- inchi key:
- InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J
- common name:
- (R)-mevalonate diphosphate
- molecular weight:
- 304.087
- Synonym(s):
- mevalonate-5-PP
- (R)-5-diphosphomevalonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-" cannot be used as a page name in this wiki.