Difference between revisions of "GLUTAMATE-N-ACETYLTRANSFERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3392 == * left end position: ** 14616 * transcription direction: ** POSITIVE * right end position: ** 16725 * centisome position: ** 86.746...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] ==
+
== Gene Tiso_gene_3392 ==
−
* smiles:
+
* left end position:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** 14616
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** gibberellin A24
+
** 16725
−
* molecular weight:
+
* centisome position:
−
** 344.407    
+
** 86.746994    
 
* Synonym(s):
 
* Synonym(s):
−
** GA24
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.2.1.47-RXN]]
−
* [[RXN1F-163]]
+
** [[pantograph]]-[[athaliana]]
−
== Reaction(s) of unknown directionality ==
+
* [[ALPHAGALACTOSID-RXN]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-11501]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-11502]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
** [[pantograph]]-[[athaliana]]
 +
* [[RXN-12088]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[RXN-17754]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[RXN-17830]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6527]]
 +
* [[PWY0-1301]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=14616}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=16725}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906]
+
{{#set: centisome position=86.746994   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.2.1.47-RXN|ALPHAGALACTOSID-RXN|RXN-11501|RXN-11502|RXN-12088|RXN-17754|RXN-17830}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861]
+
{{#set: pathway associated=PWY-6527|PWY0-1301}}
−
* HMDB : HMDB37103
+
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}}
+
−
{{#set: common name=gibberellin A24}}
+
−
{{#set: molecular weight=344.407   }}
+
−
{{#set: common name=GA24}}
+
−
{{#set: produced by=RXN1F-163}}
+

Revision as of 17:17, 10 January 2018

Gene Tiso_gene_3392

  • left end position:
    • 14616
  • transcription direction:
    • POSITIVE
  • right end position:
    • 16725
  • centisome position:
    • 86.746994
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLUTAMATE-N-ACETYLTRANSFERASE-RXN&oldid=17041"