Difference between revisions of "Tiso gene 9303"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-26 tRNA-Containing-N2-Methylguanine-26] == * common name: ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == * smiles: ** CC1(C(=C(C=CC=1)O)C([O-])=O) * inchi key: ** InChIKey=HCJMNOSI...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == |
| + | * smiles: | ||
| + | ** CC1(C(=C(C=CC=1)O)C([O-])=O) | ||
| + | * inchi key: | ||
| + | ** InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 6-methylsalicylate |
| + | * molecular weight: | ||
| + | ** 151.141 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** Methylsalicylic acid | ||
| + | ** 6-Methyl 2-hydroxybenzenecarboxylate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.3.1.165-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54693536 54693536] |
| − | {{#set: produced by= | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.5342108.html 5342108] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36658 36658] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02657 C02657] | ||
| + | {{#set: smiles=CC1(C(=C(C=CC=1)O)C([O-])=O)}} | ||
| + | {{#set: inchi key=InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=6-methylsalicylate}} | ||
| + | {{#set: molecular weight=151.141 }} | ||
| + | {{#set: common name=Methylsalicylic acid|6-Methyl 2-hydroxybenzenecarboxylate}} | ||
| + | {{#set: produced by=2.3.1.165-RXN}} | ||
Revision as of 18:17, 10 January 2018
Contents
Metabolite CPD-637
- smiles:
- CC1(C(=C(C=CC=1)O)C([O-])=O)
- inchi key:
- InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M
- common name:
- 6-methylsalicylate
- molecular weight:
- 151.141
- Synonym(s):
- Methylsalicylic acid
- 6-Methyl 2-hydroxybenzenecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C(=C(C=CC=1)O)C([O-])=O)" cannot be used as a page name in this wiki.
