Difference between revisions of "Tiso gene 10824"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17487 RXN-17487] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17487 RXN-17487] == |
| − | + | * direction: | |
| − | + | ** REVERSIBLE | |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.99 EC-1.3.99] |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[DIVINYL-PROTOCHLOROPHYLLIDE-A]][c] '''+''' 1 [[Acceptor]][c] '''<=>''' 1 [[Donor-H2]][c] '''+''' 1 [[CPD-10337]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 3,8-divinyl protochlorophyllide a[c] '''+''' 1 an oxidized electron acceptor[c] '''<=>''' 1 a reduced electron acceptor[c] '''+''' 1 chlorophyll c2[c] | |
| − | + | ||
| − | * [[ | + | == Genes associated with this reaction == |
| − | == | + | == Pathways == |
| − | * [[ | + | == Reconstruction information == |
| − | * [[ | + | * [[gap-filling]]: |
| + | ** [[meneco]]: | ||
| + | *** [[added for gapfilling]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: ec number=EC-1.3.99}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=gap-filling}} | |
| − | + | {{#set: reconstruction tool=meneco}} | |
| − | + | {{#set: reconstruction source=added for gapfilling}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:17, 10 January 2018
Contents
Reaction RXN-17487
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DIVINYL-PROTOCHLOROPHYLLIDE-A[c] + 1 Acceptor[c] <=> 1 Donor-H2[c] + 1 CPD-10337[c]
- With common name(s):
- 1 3,8-divinyl protochlorophyllide a[c] + 1 an oxidized electron acceptor[c] <=> 1 a reduced electron acceptor[c] + 1 chlorophyll c2[c]
