Difference between revisions of "3-hydroxy-cis-D9-hexaecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == * smiles: ** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14816 == * left end position: ** 1405 * transcription direction: ** POSITIVE * right end position: ** 4989 * centisome position: ** 25.9752...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] ==
+
== Gene Tiso_gene_14816 ==
−
* smiles:
+
* left end position:
−
** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
+
** 1405
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** linustatin
+
** 4989
−
* molecular weight:
+
* centisome position:
−
** 409.389    
+
** 25.975227    
 
* Synonym(s):
 
* Synonym(s):
−
** propanenitrile
 
−
** [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13602]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12195]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12196]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN0-5462]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=1405}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08333 C08333]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4989}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6483 6483]
+
{{#set: centisome position=25.975227   }}
−
* PUBCHEM:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119301 119301]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: smiles=CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
+
−
{{#set: inchi key=InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N}}
+
−
{{#set: common name=linustatin}}
+
−
{{#set: molecular weight=409.389   }}
+
−
{{#set: common name=propanenitrile|[2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]}}
+
−
{{#set: consumed by=RXN-13602}}
+

Revision as of 17:18, 10 January 2018

Gene Tiso_gene_14816

  • left end position:
    • 1405
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4989
  • centisome position:
    • 25.975227
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-hydroxy-cis-D9-hexaecenoyl-ACPs&oldid=17134"