Difference between revisions of "FACOAE1839Z12Z15Z"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == * smiles: ** CC1(=C(C2(=C(C=N1)COC2=O))O) * inchi key: ** InChIKey=HHPDVQLB...") |
(Created page with "Category:Gene == Gene Tiso_gene_1275 == * left end position: ** 19089 * transcription direction: ** POSITIVE * right end position: ** 21320 * centisome position: ** 77.515...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1275 == |
− | * | + | * left end position: |
− | ** | + | ** 19089 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 21320 |
− | * | + | * centisome position: |
− | ** | + | ** 77.51563 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * [[RXN-13185]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | * [[RXN-7984]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-7985]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5945]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=19089}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=21320}} | |
− | + | {{#set: centisome position=77.51563 }} | |
− | + | {{#set: reaction associated=RXN-13185|RXN-7984|RXN-7985}} | |
− | + | {{#set: pathway associated=PWY-5945}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:18, 10 January 2018
Gene Tiso_gene_1275
- left end position:
- 19089
- transcription direction:
- POSITIVE
- right end position:
- 21320
- centisome position:
- 77.51563
- Synonym(s):
Reactions associated
- RXN-13185
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-7984
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-7985
- in-silico_annotation
- ec-number
- in-silico_annotation