Difference between revisions of "Tiso gene 572"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...")
 
(Created page with "Category:Gene == Gene Tiso_gene_19413 == * left end position: ** 867 * transcription direction: ** POSITIVE * right end position: ** 2300 * centisome position: ** 37.06712...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
+
== Gene Tiso_gene_19413 ==
−
* smiles:
+
* left end position:
−
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
+
** 867
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
+
** POSITIVE
−
* common name:
+
* right end position:
−
** queuine
+
** 2300
−
* molecular weight:
+
* centisome position:
−
** 278.29    
+
** 37.06712    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
 
−
** base Q
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[CARBODEHYDRAT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
−
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
***ec-number
 +
* [[RXN0-5224]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-241]]
 +
* [[PWYQT-4429]]
 +
* [[PWY-7117]]
 +
* [[PWY-7115]]
 +
* [[PWY-6142]]
 +
* [[CYANCAT-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=867}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2300}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
+
{{#set: centisome position=37.06712   }}
−
* HMDB : HMDB01495
+
{{#set: reaction associated=CARBODEHYDRAT-RXN|RXN0-5224}}
−
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
+
{{#set: pathway associated=PWY-241|PWYQT-4429|PWY-7117|PWY-7115|PWY-6142|CYANCAT-PWY}}
−
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
+
−
{{#set: common name=queuine}}
+
−
{{#set: molecular weight=278.29   }}
+
−
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}}
+
−
{{#set: consumed or produced by=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
+

Revision as of 17:18, 10 January 2018

Gene Tiso_gene_19413

  • left end position:
    • 867
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2300
  • centisome position:
    • 37.06712
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_572&oldid=17188"