Difference between revisions of "RXN1G-182"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-607 RXN1G-607] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == * smiles: ** CC1(=C(C2(=C(C=N1)COC2=O))O) * inchi key: ** InChIKey=HHPDVQLB...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(=C(C2(=C(C=N1)COC2=O))O) |
| + | * inchi key: | ||
| + | ** InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-pyridoxolactone |
| − | * | + | * molecular weight: |
| − | ** | + | ** 165.148 |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[PYRIDOXAL-4-DEHYDROGENASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=151228 151228] | |
| − | + | * CHEMSPIDER: | |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.133287.html 133287] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16871 16871] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00971 C00971] |
| + | * HMDB : HMDB03454 | ||
| + | {{#set: smiles=CC1(=C(C2(=C(C=N1)COC2=O))O)}} | ||
| + | {{#set: inchi key=InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=4-pyridoxolactone}} | ||
| + | {{#set: molecular weight=165.148 }} | ||
| + | {{#set: produced by=PYRIDOXAL-4-DEHYDROGENASE-RXN}} | ||
Revision as of 17:19, 10 January 2018
Contents
Metabolite CPD-375
- smiles:
- CC1(=C(C2(=C(C=N1)COC2=O))O)
- inchi key:
- InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N
- common name:
- 4-pyridoxolactone
- molecular weight:
- 165.148
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
