Difference between revisions of "CPD-11444"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] == * smiles: ** CSCCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=MJGXIOUQXYX...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCCCCC(=O)C([O-])=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.17.7.1 EC-1.17.7.1]
+
** InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M
 +
* common name:
 +
** 9-(methylthio)-2-oxononanoate
 +
* molecular weight:
 +
** 217.302   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9-(methylthio)-2-oxononanoic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''=>''' 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c] '''+''' 1 [[WATER]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
+
* [[RXN-18203]]
−
* With common name(s):
+
* [[RXNQT-4174]]
−
** 1 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[c] '''+''' 1 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''=>''' 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c] '''+''' 1 H2O[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15758]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08689 R08689]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237169 44237169]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* KNAPSACK : C00007654
−
{{#set: ec number=EC-1.17.7.1}}
+
{{#set: smiles=CSCCCCCCCC(=O)C([O-])=O}}
−
{{#set: gene associated=Tiso_gene_15758}}
+
{{#set: inchi key=InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M}}
−
{{#set: in pathway=PWY-7560}}
+
{{#set: common name=9-(methylthio)-2-oxononanoate}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=217.302    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=9-(methylthio)-2-oxononanoic acid}}
−
{{#set: reconstruction source=synechocystis|esiliculosus}}
+
{{#set: produced by=RXN-18203|RXNQT-4174}}

Revision as of 17:19, 10 January 2018

Metabolite CPDQT-30

  • smiles:
    • CSCCCCCCCC(=O)C([O-])=O
  • inchi key:
    • InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M
  • common name:
    • 9-(methylthio)-2-oxononanoate
  • molecular weight:
    • 217.302
  • Synonym(s):
    • 9-(methylthio)-2-oxononanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007654
"CSCCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11444&oldid=17231"