Difference between revisions of "Tiso gene 14664"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13607 RXN-13607] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13607 RXN-13607] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
 +
* inchi key:
 +
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
 
* common name:
 
* common name:
−
** exostosin_family_protein
+
** queuine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
+
** 278.29   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
 +
** base Q
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[UDP-GLUCURONATE]][c] '''+''' 1 [[CPD-14601]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[CPD-14602]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
−
** 1 UDP-α-D-glucuronate[c] '''+''' 1 mycophenolate[c] '''=>''' 1 UDP[c] '''+''' 1 mycophenolic acid O-acyl-glucuronide[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14141]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_14140]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=exostosin_family_protein}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
−
{{#set: ec number=EC-2.4.1.17}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_14141|Tiso_gene_14140}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
−
{{#set: in pathway=}}
+
* HMDB : HMDB01495
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=queuine}}
 +
{{#set: molecular weight=278.29    }}
 +
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}}
 +
{{#set: consumed or produced by=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}

Revision as of 17:19, 10 January 2018

Metabolite QUEUINE

  • smiles:
    • C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
  • inchi key:
    • InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
  • common name:
    • queuine
  • molecular weight:
    • 278.29
  • Synonym(s):
    • 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
    • base Q

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14664&oldid=17239"