Difference between revisions of "R06858"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] == * smiles: ** COC1(C=C(C=CCO)C=C(OC)C(O)=1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_4842 == * Synonym(s): == Reactions associated == * 3.4.21.4-RXN ** pantograph-esiliculosus == Pathways associated == == Extern...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_4842 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * [[3.4.21.4-RXN]] | |
| − | * [[RXN- | + | ** [[pantograph]]-[[esiliculosus]] |
| − | == | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=3.4.21.4-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 17:19, 10 January 2018
Gene Tiso_gene_4842
- Synonym(s):
