Difference between revisions of "RXN1F-148"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14515 RXN-14515] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] == * smiles: ** C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] == |
− | * | + | * smiles: |
− | ** | + | ** C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) |
+ | * inchi key: | ||
+ | ** InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F | ||
+ | * common name: | ||
+ | ** D-myo-inositol (3,4,5,6)-tetrakisphosphate | ||
+ | * molecular weight: | ||
+ | ** 492.013 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Ins(3,4,5,6)P4 | ||
+ | ** Inositol 3,4,5,6-tetrakisphosphate | ||
+ | ** 1D-myo-inositol 3,4,5,6-tetrakisphosphate | ||
+ | ** I(3,4,5,6)P4 | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[2.7.1.134-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10955]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04520 C04520] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57539 57539] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57539 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201333 25201333] | ||
+ | * HMDB : HMDB03848 | ||
+ | {{#set: smiles=C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} | ||
+ | {{#set: inchi key=InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F}} | ||
+ | {{#set: common name=D-myo-inositol (3,4,5,6)-tetrakisphosphate}} | ||
+ | {{#set: molecular weight=492.013 }} | ||
+ | {{#set: common name=Ins(3,4,5,6)P4|Inositol 3,4,5,6-tetrakisphosphate|1D-myo-inositol 3,4,5,6-tetrakisphosphate|I(3,4,5,6)P4}} | ||
+ | {{#set: consumed by=2.7.1.134-RXN}} | ||
+ | {{#set: produced by=RXN-10955}} |
Revision as of 18:20, 10 January 2018
Contents
Metabolite CPD-178
- smiles:
- C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
- inchi key:
- InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F
- common name:
- D-myo-inositol (3,4,5,6)-tetrakisphosphate
- molecular weight:
- 492.013
- Synonym(s):
- Ins(3,4,5,6)P4
- Inositol 3,4,5,6-tetrakisphosphate
- 1D-myo-inositol 3,4,5,6-tetrakisphosphate
- I(3,4,5,6)P4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.