Difference between revisions of "CPD1F-130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO * inchi key: ** InChIKey=U...") |
(Created page with "Category:Gene == Gene Tiso_gene_7622 == * Synonym(s): == Reactions associated == * 2.1.1.79-RXN ** pantograph-esiliculosus * RXN1G-2544 ** pantograph-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7622 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[2.1.1.79-RXN]] |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[ | + | * [[RXN1G-2544]] |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | == | + | * [[RXN1G-3641]] |
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY0-541]] | ||
+ | * [[PWYG-321]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.1.1.79-RXN|RXN1G-2544|RXN1G-3641}} | |
− | + | {{#set: pathway associated=PWY0-541|PWYG-321}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 17:20, 10 January 2018
Gene Tiso_gene_7622
- Synonym(s):