Difference between revisions of "Cis-cis-D11-23-C42-2-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00471 R00471] == * direction: ** LEFT-TO-RIGHT * common name: ** R63 * Synonym(s): == Reaction Fo...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00471 R00471] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
 +
* inchi key:
 +
** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
 
* common name:
 
* common name:
−
** R63
+
** delphinidin-3-O-β-D-glucoside
 +
* molecular weight:
 +
** 463.374   
 
* Synonym(s):
 
* Synonym(s):
 +
** delfinidin-3-O-glucoside
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-8228]]
−
** 1.0 [[D-4-HYDROXY-2-KETO-GLUTARATE]][c] '''=>''' 1.0 [[GLYOX]][c] '''+''' 1.0 [[PYRUVATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 (4R)-4-hydroxy-2-oxoglutarate[c] '''=>''' 1.0 glyoxylate[c] '''+''' 1.0 pyruvate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12620]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIPID_MAPS : LMPK12010278
−
{{#set: common name=R63}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_12620}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515359 102515359]
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=synechocystis}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138]
 +
* HMDB : HMDB37997
 +
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}}
 +
{{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}}
 +
{{#set: common name=delphinidin-3-O-β-D-glucoside}}
 +
{{#set: molecular weight=463.374    }}
 +
{{#set: common name=delfinidin-3-O-glucoside}}
 +
{{#set: consumed by=RXN-8228}}

Revision as of 17:20, 10 January 2018

Metabolite CPD-7117

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
  • inchi key:
    • InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
  • common name:
    • delphinidin-3-O-β-D-glucoside
  • molecular weight:
    • 463.374
  • Synonym(s):
    • delfinidin-3-O-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-cis-D11-23-C42-2-ACPs&oldid=17321"