Difference between revisions of "RXN-9654"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == * smiles: ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_15060 == * left end position: ** 305 * transcription direction: ** POSITIVE * right end position: ** 4815 * centisome position: ** 5.798479...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] ==
+
== Gene Tiso_gene_15060 ==
* smiles:
+
* left end position:
** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O
+
** 305
* inchi key:
+
* transcription direction:
** InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L
+
** POSITIVE
* common name:
+
* right end position:
** GDP-β-L-gulose
+
** 4815
* molecular weight:
+
* centisome position:
** 603.329    
+
** 5.798479    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[2.7.11.24-RXN]]
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
* [[RXN-7772]]
+
***ec-number
* [[RXN-7771]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=305}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657274 90657274]
+
{{#set: transcription direction=POSITIVE}}
* LIGAND-CPD:
+
{{#set: right end position=4815}}
** [http://www.genome.jp/dbget-bin/www_bget?C15925 C15925]
+
{{#set: centisome position=5.798479   }}
{{#set: smiles=C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O}}
+
{{#set: reaction associated=2.7.11.24-RXN}}
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L}}
+
{{#set: common name=GDP-β-L-gulose}}
+
{{#set: molecular weight=603.329   }}
+
{{#set: consumed or produced by=RXN-7772|RXN-7771}}
+

Revision as of 17:20, 10 January 2018

Gene Tiso_gene_15060

  • left end position:
    • 305
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4815
  • centisome position:
    • 5.798479
  • Synonym(s):

Reactions associated

Pathways associated

External links