Difference between revisions of "Tiso gene 11824"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17381 == * Synonym(s): == Reactions associated == * 1.18.1.2-RXN ** pantograph-esiliculosus * RXN-17897 ** pantograph-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == |
+ | * smiles: | ||
+ | ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N | ||
+ | * common name: | ||
+ | ** 24-methylenecycloartanol | ||
+ | * molecular weight: | ||
+ | ** 440.751 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 24(28)-methylenecycloartanol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-4021]] | |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21157981 21157981] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830] | ||
+ | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}} | ||
+ | {{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}} | ||
+ | {{#set: common name=24-methylenecycloartanol}} | ||
+ | {{#set: molecular weight=440.751 }} | ||
+ | {{#set: common name=24(28)-methylenecycloartanol}} | ||
+ | {{#set: produced by=RXN-4021}} |
Revision as of 17:21, 10 January 2018
Contents
Metabolite CPD-696
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
- inchi key:
- InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
- common name:
- 24-methylenecycloartanol
- molecular weight:
- 440.751
- Synonym(s):
- 24(28)-methylenecycloartanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.