Difference between revisions of "RXN-13323"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG-tRNAs ARG-tRNAs] == * common name: ** a tRNAarg * Synonym(s): ** TRNA(ARG) == Reaction(s)...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG-tRNAs ARG-tRNAs] ==
* smiles:
+
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
* inchi key:
+
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 14-hydroxylanosterol
+
** a tRNAarg
* molecular weight:
+
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
+
** TRNA(ARG)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-304]]
+
* [[ARGININE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-303]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a tRNAarg}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
+
{{#set: common name=TRNA(ARG)}}
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: consumed by=ARGININE--TRNA-LIGASE-RXN}}
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
+
{{#set: common name=14-hydroxylanosterol}}
+
{{#set: molecular weight=442.724    }}
+
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN66-304}}
+
{{#set: produced by=RXN66-303}}
+

Revision as of 17:22, 10 January 2018

Metabolite ARG-tRNAs

  • common name:
    • a tRNAarg
  • Synonym(s):
    • TRNA(ARG)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links