Difference between revisions of "Tiso gene 10247"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE ALPHA-RIBAZOLE] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3))) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11569 RXN-11569] == * direction: ** LEFT-TO-RIGHT * common name: ** iduronate-2-sulfatase * ec...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11569 RXN-11569] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** iduronate-2-sulfatase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.6.13 EC-3.1.6.13] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[Dermatan-sulfate-L-IdoA2S]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[DERMATAN-L-IDURONATE]][c] '''+''' 1 [[SULFATE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H2O[c] '''+''' 1 [dermatan-sulfate]-2-O-sulfo-α-L-iduronate[c] '''=>''' 2 H+[c] '''+''' 1 [dermatan]-α-L-iduronate[c] '''+''' 1 sulfate[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_18595]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=iduronate-2-sulfatase}} | |
− | + | {{#set: ec number=EC-3.1.6.13}} | |
− | + | {{#set: gene associated=Tiso_gene_18595}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | {{#set: reconstruction source=in-silico_annotation}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:22, 10 January 2018
Contents
Reaction RXN-11569
- direction:
- LEFT-TO-RIGHT
- common name:
- iduronate-2-sulfatase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Dermatan-sulfate-L-IdoA2S[c] => 2 PROTON[c] + 1 DERMATAN-L-IDURONATE[c] + 1 SULFATE[c]
- With common name(s):
- 1 H2O[c] + 1 [dermatan-sulfate]-2-O-sulfo-α-L-iduronate[c] => 2 H+[c] + 1 [dermatan]-α-L-iduronate[c] + 1 sulfate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_18595
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- IN-SILICO_ANNOTATION