Difference between revisions of "Tiso gene 4094"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_NA+ ExchangeSeed_NA+] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-408 RXN1G-408] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta5,17-3-oxo-C36...") |
||
| Line 1: | Line 1: | ||
[[Category:Reaction]] | [[Category:Reaction]] | ||
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object= | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-408 RXN1G-408] == |
* direction: | * direction: | ||
| − | ** | + | ** LEFT-TO-RIGHT |
| + | * common name: | ||
| + | ** cis,cis-delta5,17-3-oxo-C36:2-[acyl-carrier protein] reductase | ||
| + | * ec number: | ||
| + | ** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9] | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction Formula == | == Reaction Formula == | ||
* With identifiers: | * With identifiers: | ||
| − | ** 1 | + | ** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[cis-cis-D5-17-3-oxo-C36-2-ACPs]][c] '''=>''' 1 [[cis-cis-D5-17-3-hydroxyC36-2-ACPs]][c] '''+''' 1 [[NADP]][c] |
* With common name(s): | * With common name(s): | ||
| − | ** 1 | + | ** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a cis,cis-delta5,17-3-oxo-C36:2-[acp][c] '''=>''' 1 a cis,cis-delta5,17-3-hydroxyC36:2[acp][c] '''+''' 1 NADP+[c] |
== Genes associated with this reaction == | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_13083]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
== Pathways == | == Pathways == | ||
| + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
| + | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
== Reconstruction information == | == Reconstruction information == | ||
| − | * [[ | + | * [[orthology]]: |
| − | ** [[ | + | ** [[pantograph]]: |
| + | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
| − | {{#set: direction= | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: in pathway=}} | + | {{#set: common name=cis,cis-delta5,17-3-oxo-C36:2-[acyl-carrier protein] reductase}} |
| − | {{#set: reconstruction category= | + | {{#set: ec number=EC-1.1.1.M9}} |
| − | {{#set: reconstruction source= | + | {{#set: gene associated=Tiso_gene_13083}} |
| + | {{#set: in pathway=PWYG-321}} | ||
| + | {{#set: reconstruction category=orthology}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
| + | {{#set: reconstruction source=esiliculosus}} | ||
Revision as of 17:22, 10 January 2018
Contents
Reaction RXN1G-408
- direction:
- LEFT-TO-RIGHT
- common name:
- cis,cis-delta5,17-3-oxo-C36:2-[acyl-carrier protein] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 NADPH[c] + 1 cis-cis-D5-17-3-oxo-C36-2-ACPs[c] => 1 cis-cis-D5-17-3-hydroxyC36-2-ACPs[c] + 1 NADP[c]
- With common name(s):
- 1 H+[c] + 1 NADPH[c] + 1 a cis,cis-delta5,17-3-oxo-C36:2-[acp][c] => 1 a cis,cis-delta5,17-3-hydroxyC36:2[acp][c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
"cis,cis-delta5,17-3-oxo-C36:2-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.
