Difference between revisions of "Tiso gene 1131"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17722 == * left end position: ** 301 * transcription direction: ** POSITIVE * right end position: ** 1412 * centisome position: ** 8.609840...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
+
== Gene Tiso_gene_17722 ==
−
* smiles:
+
* left end position:
−
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
+
** 301
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
+
** 1412
−
* molecular weight:
+
* centisome position:
−
** 262.262    
+
** 8.609840    
 
* Synonym(s):
 
* Synonym(s):
−
** salicyl-HCH
 
−
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
 
−
** acylsaligenin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12252]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 529507-98-0
+
{{#set: left end position=301}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
+
{{#set: right end position=1412}}
−
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
+
{{#set: centisome position=8.609840   }}
−
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
+
−
{{#set: molecular weight=262.262   }}
+
−
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
+
−
{{#set: consumed by=RXN-12252}}
+

Revision as of 17:23, 10 January 2018

Gene Tiso_gene_17722

  • left end position:
    • 301
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1412
  • centisome position:
    • 8.609840
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1131&oldid=17566"