Difference between revisions of "Tiso gene 17123"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] == * smiles: ** C1(=CNC2(=C1C=C(O)C(O)=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_14845 == * left end position: ** 4404 * transcription direction: ** POSITIVE * right end position: ** 5385 * centisome position: ** 81.6311...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14845 == |
− | * | + | * left end position: |
− | ** | + | ** 4404 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5385 |
− | * | + | * centisome position: |
− | ** | + | ** 81.63114 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-13908]] | |
− | * [[RXN- | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-7908]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PHENYLALANINE-DEG1-PWY]] | ||
+ | * [[PWY-7158]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4404}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5385}} | |
− | + | {{#set: centisome position=81.63114 }} | |
− | + | {{#set: reaction associated=RXN-13908|RXN-7908}} | |
− | + | {{#set: pathway associated=PHENYLALANINE-DEG1-PWY|PWY-7158}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:23, 10 January 2018
Gene Tiso_gene_14845
- left end position:
- 4404
- transcription direction:
- POSITIVE
- right end position:
- 5385
- centisome position:
- 81.63114
- Synonym(s):
Reactions associated
- RXN-13908
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-7908
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation