Difference between revisions of "Pimeloyl-ACPs"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15582 == * Synonym(s): == Reactions associated == * DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN ** pantograph-esiliculosus * H2NEOPTE...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == |
| + | * smiles: | ||
| + | ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** delphinidin | ||
| + | * molecular weight: | ||
| + | ** 301.232 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** delfinidin | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-9723]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[RXN-7785]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203213 25203213] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28436 28436] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05908 C05908] | ||
| + | * HMDB : HMDB03074 | ||
| + | {{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))}} | ||
| + | {{#set: inchi key=InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=delphinidin}} | ||
| + | {{#set: molecular weight=301.232 }} | ||
| + | {{#set: common name=delfinidin}} | ||
| + | {{#set: consumed by=RXN-9723}} | ||
| + | {{#set: produced by=RXN-7785}} | ||
Revision as of 17:24, 10 January 2018
Contents
Metabolite CPD-7090
- smiles:
- C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
- inchi key:
- InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
- common name:
- delphinidin
- molecular weight:
- 301.232
- Synonym(s):
- delfinidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))" cannot be used as a page name in this wiki.
