Difference between revisions of "CPD-13713"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5087 == * Synonym(s): == Reactions associated == * RIBITOL-2-DEHYDROGENASE-RXN ** pantograph-esiliculosus == Pathways associat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == * smiles: ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O * inchi key: ** I...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == |
+ | * smiles: | ||
+ | ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=NCYCYZXNIZJOKI-OVSJKPMPSA-N | ||
+ | * common name: | ||
+ | ** all-trans-retinal | ||
+ | * molecular weight: | ||
+ | ** 284.441 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** vitamin A aldehyde | ||
+ | ** retinene | ||
+ | ** axerophthal | ||
+ | ** retinaldehyde | ||
+ | ** retinal | ||
+ | ** all-trans-Vitamin A aldehyde | ||
+ | ** all-trans-retinene | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13374]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | * [[RETINOL-DEHYDROGENASE-RXN]] |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 116-31-4 |
− | {{#set: | + | * LIPID_MAPS : LMPR01090002 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=638015 638015] | ||
+ | * HMDB : HMDB01358 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00376 C00376] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.553582.html 553582] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17898 17898] | ||
+ | * METABOLIGHTS : MTBLC17898 | ||
+ | {{#set: smiles=CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O}} | ||
+ | {{#set: inchi key=InChIKey=NCYCYZXNIZJOKI-OVSJKPMPSA-N}} | ||
+ | {{#set: common name=all-trans-retinal}} | ||
+ | {{#set: molecular weight=284.441 }} | ||
+ | {{#set: common name=vitamin A aldehyde|retinene|axerophthal|retinaldehyde|retinal|all-trans-Vitamin A aldehyde|all-trans-retinene}} | ||
+ | {{#set: produced by=RXN-13374}} | ||
+ | {{#set: consumed or produced by=RETINOL-DEHYDROGENASE-RXN}} |
Revision as of 18:24, 10 January 2018
Contents
Metabolite RETINAL
- smiles:
- CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O
- inchi key:
- InChIKey=NCYCYZXNIZJOKI-OVSJKPMPSA-N
- common name:
- all-trans-retinal
- molecular weight:
- 284.441
- Synonym(s):
- vitamin A aldehyde
- retinene
- axerophthal
- retinaldehyde
- retinal
- all-trans-Vitamin A aldehyde
- all-trans-retinene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 116-31-4
- LIPID_MAPS : LMPR01090002
- PUBCHEM:
- HMDB : HMDB01358
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17898
"CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O" cannot be used as a page name in this wiki.