Difference between revisions of "Tiso gene 15179"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * smiles: ** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-] * inchi key: ** I...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN] == * direction: ** LEF...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** myo-inositol-1-phosphate_synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.5.1.4 EC-5.5.1.4] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[D-glucopyranose-6-phosphate]][c] '''=>''' 1 [[1-L-MYO-INOSITOL-1-P]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 D-glucopyranose 6-phosphate[c] '''=>''' 1 1D-myo-inositol 3-monophosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_7167]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-2301]], myo-inositol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2301 PWY-2301] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-4661]], 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4661 PWY-4661] | ||
+ | ** '''3''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-6580]], phosphatidylinositol biosynthesis I (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6580 PWY-6580] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6664]], di-myo-inositol phosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6664 PWY-6664] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY1G-0]], mycothiol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1G-0 PWY1G-0] | ||
+ | ** '''1''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6372]], 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372] | ||
+ | ** '''3''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[esiliculosus]] | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[experimental_annotation]] | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10716 10716] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07324 R07324] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P42800 P42800] |
− | * | + | ** [http://www.uniprot.org/uniprot/P42802 P42802] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P42803 P42803] |
− | + | ** [http://www.uniprot.org/uniprot/Q9FPK7 Q9FPK7] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O65195 O65195] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P42801 P42801] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q96348 Q96348] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q41107 Q41107] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q40271 Q40271] |
+ | ** [http://www.uniprot.org/uniprot/Q18664 Q18664] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9LX12 Q9LX12] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=myo-inositol-1-phosphate_synthase}} | ||
+ | {{#set: ec number=EC-5.5.1.4}} | ||
+ | {{#set: gene associated=Tiso_gene_7167}} | ||
+ | {{#set: in pathway=PWY-2301|PWY-4661|PWY-6580|PWY-6664|PWY1G-0|PWY-6372}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction tool=pantograph}} | ||
+ | {{#set: reconstruction source=esiliculosus}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} | ||
+ | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} |
Revision as of 17:25, 10 January 2018
Contents
Reaction MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- myo-inositol-1-phosphate_synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 D-glucopyranose-6-phosphate[c] => 1 1-L-MYO-INOSITOL-1-P[c]
- With common name(s):
- 1 D-glucopyranose 6-phosphate[c] => 1 1D-myo-inositol 3-monophosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_7167
- IN-SILICO_ANNOTATION
- EC-NUMBER
- pantograph-esiliculosus
- IN-SILICO_ANNOTATION
Pathways
- PWY-2301, myo-inositol biosynthesis: PWY-2301
- 2 reactions found over 2 reactions in the full pathway
- PWY-4661, 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza): PWY-4661
- 3 reactions found over 7 reactions in the full pathway
- PWY-6580, phosphatidylinositol biosynthesis I (bacteria): PWY-6580
- 1 reactions found over 3 reactions in the full pathway
- PWY-6664, di-myo-inositol phosphate biosynthesis: PWY-6664
- 1 reactions found over 4 reactions in the full pathway
- PWY1G-0, mycothiol biosynthesis: PWY1G-0
- 1 reactions found over 6 reactions in the full pathway
- PWY-6372, 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium): PWY-6372
- 3 reactions found over 7 reactions in the full pathway
Reconstruction information
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: