Difference between revisions of "COPROPORPHYRINOGEN III"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14225 RXN-14225] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.2...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14225 RXN-14225] ==
* smiles:
+
* direction:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
+
** REVERSIBLE
* common name:
+
* ec number:
** geranylgeranyl chlorophyll b
+
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
* molecular weight:
+
** 901.439   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[D-GLUCURONOLACTONE]][c] '''+''' 1 [[NAD]][c] '''+''' 2 [[WATER]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[D-GLUCARATE]][c] '''+''' 3 [[PROTON]][c]
* [[RXN-7673]]
+
* With common name(s):
 +
** 1 D-glucurono-6,3-lactone[c] '''+''' 1 NAD+[c] '''+''' 2 H2O[c] '''<=>''' 1 NADH[c] '''+''' 1 D-glucarate[c] '''+''' 3 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3513]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[Tiso_gene_7322]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
*** [[athaliana]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245917 25245917]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30886 30886]
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}}
+
* LIGAND-RXN:
{{#set: common name=geranylgeranyl chlorophyll b}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R02957 R02957]
{{#set: molecular weight=901.439    }}
+
{{#set: direction=REVERSIBLE}}
{{#set: consumed or produced by=RXN-7673}}
+
{{#set: ec number=EC-1.2.1.3}}
 +
{{#set: gene associated=Tiso_gene_3513|Tiso_gene_7322}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=esiliculosus|athaliana}}

Revision as of 18:25, 10 January 2018

Reaction RXN-14225

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links