Difference between revisions of "Tiso gene 15285"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPARAGINESYN-PWY ASPARAGINESYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?obje...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAURINE TAURINE] == * smiles: ** C(S(=O)(=O)[O-])C[N+] * inchi key: ** InChIKey=XOAAWQZATWQOTB-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAURINE TAURINE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(S(=O)(=O)[O-])C[N+] |
− | ** | + | * inchi key: |
+ | ** InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** taurine |
+ | * molecular weight: | ||
+ | ** 125.142 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-aminoethanesulfonate | ||
+ | ** tauphon | ||
+ | ** taufon | ||
+ | ** 2-aminoethanesulfonic acid | ||
+ | ** aminoetylsulphonic acid | ||
+ | ** ethylaminesulphonic acid | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN0-299]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 107-35-7 |
− | ** [http:// | + | * METABOLIGHTS : MTBLC507393 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4068592 4068592] |
− | {{#set: common name= | + | * HMDB : HMDB00251 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00245 C00245] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=507393 507393] | ||
+ | * BIGG : taur | ||
+ | {{#set: smiles=C(S(=O)(=O)[O-])C[N+]}} | ||
+ | {{#set: inchi key=InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=taurine}} | ||
+ | {{#set: molecular weight=125.142 }} | ||
+ | {{#set: common name=2-aminoethanesulfonate|tauphon|taufon|2-aminoethanesulfonic acid|aminoetylsulphonic acid|ethylaminesulphonic acid}} | ||
+ | {{#set: consumed by=RXN0-299}} |
Revision as of 15:33, 10 January 2018
Contents
Metabolite TAURINE
- smiles:
- C(S(=O)(=O)[O-])C[N+]
- inchi key:
- InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N
- common name:
- taurine
- molecular weight:
- 125.142
- Synonym(s):
- 2-aminoethanesulfonate
- tauphon
- taufon
- 2-aminoethanesulfonic acid
- aminoetylsulphonic acid
- ethylaminesulphonic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 107-35-7
- METABOLIGHTS : MTBLC507393
- PUBCHEM:
- HMDB : HMDB00251
- LIGAND-CPD:
- CHEBI:
- BIGG : taur
"C(S(=O)(=O)[O-])C[N+" cannot be used as a page name in this wiki.