Difference between revisions of "3-Hydroxyglutaryl-ACP-methyl-ester"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11401 == * Synonym(s): == Reactions associated == * GLCUR1PUT ** pantograph-creinhardtii * GLUC1PURIDYLTRANS-RXN ** pant...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] == * smiles: ** CC(CO)=CCOP(OP([O-])(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-METHYL-BUTENYL-DIP HYDROXY-METHYL-BUTENYL-DIP] == |
+ | * smiles: | ||
+ | ** CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=MDSIZRKJVDMQOQ-GORDUTHDSA-K | ||
+ | * common name: | ||
+ | ** (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate | ||
+ | * molecular weight: | ||
+ | ** 259.069 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (E)-4-hydroxy-3-methylbut 2-en-1-yl diphosphate | ||
+ | ** HMBDP | ||
+ | ** 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ISPH2-RXN]] |
− | + | * [[RXN0-884]] | |
− | * [[ | + | * [[IDS2]] |
− | + | * [[R07219]] | |
− | * [[ | + | * [[IDS1]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN0-882]] |
− | * [[ | + | * [[RXN-15878]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | * [[HDS]] | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21597501 21597501] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10224038.html 10224038] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=128753 128753] | ||
+ | * BIGG : h2mb4p | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11811 C11811] | ||
+ | {{#set: smiles=CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=MDSIZRKJVDMQOQ-GORDUTHDSA-K}} | ||
+ | {{#set: common name=(E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}} | ||
+ | {{#set: molecular weight=259.069 }} | ||
+ | {{#set: common name=(E)-4-hydroxy-3-methylbut 2-en-1-yl diphosphate|HMBDP|1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate}} | ||
+ | {{#set: consumed by=ISPH2-RXN|RXN0-884|IDS2|R07219|IDS1}} | ||
+ | {{#set: produced by=RXN0-882|RXN-15878}} | ||
+ | {{#set: consumed or produced by=HDS}} |
Revision as of 17:26, 10 January 2018
Contents
Metabolite HYDROXY-METHYL-BUTENYL-DIP
- smiles:
- CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-]
- inchi key:
- InChIKey=MDSIZRKJVDMQOQ-GORDUTHDSA-K
- common name:
- (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
- molecular weight:
- 259.069
- Synonym(s):
- (E)-4-hydroxy-3-methylbut 2-en-1-yl diphosphate
- HMBDP
- 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CO)=CCOP(OP([O-])(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.